CAS 361365-08-4 is the registry number for 5,6-Dichloro-1H,2H,3H-imidazo(4,5-b)pyridin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6-dichloro-1,3-dihydroimidazo[4,5-b]pyridin-2-one (CAS 361365-08-4) is a chemical compound with the molecular formula C6H3Cl2N3O and a molecular weight of 204.01 g/mol. IUPAC name: 5,6-dichloro-1,3-dihydroimidazo[4,5-b]pyridin-2-one. InChIKey: ITKBBOLEUZVKAE-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3O |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 5,6-dichloro-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| InChIKey | ITKBBOLEUZVKAE-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Cl)Cl)NC(=O)N2 |
Computed by PubChem (NCBI)