CAS 330982-41-7 is the registry number for 5,7-Dichloro-2,1,3-benzoxadiazol-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5,7-dichloro-2,1,3-benzoxadiazol-4-amine (CAS 330982-41-7) is a chemical compound with the molecular formula C6H3Cl2N3O and a molecular weight of 204.01 g/mol. IUPAC name: 5,7-dichloro-2,1,3-benzoxadiazol-4-amine. InChIKey: LPYPMZSBOBFGBF-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3O |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 5,7-dichloro-2,1,3-benzoxadiazol-4-amine |
| InChIKey | LPYPMZSBOBFGBF-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1Cl)N)Cl |
Computed by PubChem (NCBI)