CAS 125372-33-0 is the registry number for Acopafant. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide (CAS 125372-33-0) is a chemical compound with the molecular formula C12H11N3OS and a molecular weight of 245.30 g/mol. IUPAC name: (3R)-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide. InChIKey: ARFOASMERCHFBY-GFCCVEGCSA-N.
| Molecular formula | C12H11N3OS |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | (3R)-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
| InChIKey | ARFOASMERCHFBY-GFCCVEGCSA-N |
| SMILES | C1C2=C(C=CN2[C@H](S1)C3=CN=CC=C3)C(=O)N |
Computed by PubChem (NCBI)