CAS 2446211-84-1 appears in our catalog under these names: (S)–3–(1–Aminopropyl)benzonitrile hydrochloride, 3-[(1S)-1-Aminopropyl]benzonitrile hydrochloride, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
3-[(1S)-1-aminopropyl]benzonitrile;hydrochloride (CAS 2446211-84-1) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 3-[(1S)-1-aminopropyl]benzonitrile;hydrochloride. InChIKey: XTSNURVDNKGGJE-PPHPATTJSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 3-[(1S)-1-aminopropyl]benzonitrile;hydrochloride |
| InChIKey | XTSNURVDNKGGJE-PPHPATTJSA-N |
| SMILES | CC[C@@H](C1=CC=CC(=C1)C#N)N.Cl |
Computed by PubChem (NCBI)