CAS 1309598-65-9 is the registry number for (S)-1-(2,4-Difluorophenyl)propan-1-amine hydrochloride 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(2,4-difluorophenyl)propan-1-amine;hydrochloride (CAS 1309598-65-9) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: (1S)-1-(2,4-difluorophenyl)propan-1-amine;hydrochloride. InChIKey: YXYGIKPAUSGSLO-FVGYRXGTSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (1S)-1-(2,4-difluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | YXYGIKPAUSGSLO-FVGYRXGTSA-N |
| SMILES | CC[C@@H](C1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)