CAS 1253926-06-5 appears in our catalog under these names: (4-Bromo-1h-indol-1-yl)acetic acid, 95%, 2-(4-Bromo-1h-indol-1-yl)acetic acid, 95%, 95%, 2-(4-Bromo-1h-indol-1-yl)acetic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(4-bromoindol-1-yl)acetic acid (CAS 1253926-06-5) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(4-bromoindol-1-yl)acetic acid. InChIKey: NASXPAJVXYXFQT-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(4-bromoindol-1-yl)acetic acid |
| InChIKey | NASXPAJVXYXFQT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2CC(=O)O)C(=C1)Br |
Computed by PubChem (NCBI)