CAS 125404-00-4 appears in our catalog under these names: 4–Naphthalen–1–ylaniline, 4-Naphthalen-1-ylaniline, 98%, 4-(1-Naphthalenyl)benzenamine, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100g, 10g, 25g, 5g, 1g.
4-naphthalen-1-ylaniline (CAS 125404-00-4) is a chemical compound with the molecular formula C16H13N and a molecular weight of 219.28 g/mol. IUPAC name: 4-naphthalen-1-ylaniline. InChIKey: OGHOZWNRKYYYHY-UHFFFAOYSA-N.
| Molecular formula | C16H13N |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 4-naphthalen-1-ylaniline |
| InChIKey | OGHOZWNRKYYYHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)