CAS 1254475-68-7 appears in our catalog under these names: 3-Fluoro-isonicotinic acid tert-butyl ester, 95%, tert-Butyl 3-fluoropyridine-4-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 3-fluoropyridine-4-carboxylate (CAS 1254475-68-7) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: tert-butyl 3-fluoropyridine-4-carboxylate. InChIKey: QVFMZEBJUUOKCF-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | tert-butyl 3-fluoropyridine-4-carboxylate |
| InChIKey | QVFMZEBJUUOKCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=NC=C1)F |
Computed by PubChem (NCBI)