CAS 1254567-53-7 appears in our catalog under these names: 3-(1H-Pyrrolo[2,3-b]pyridin-5-yl)propanoic acid, 95%, 3-(1H-PYRROLO[2,3-B]PYRIDIN-5-YL)PROPANOIC ACID, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanoic acid (CAS 1254567-53-7) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanoic acid. InChIKey: UTOAXDSCYKJUMT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanoic acid |
| InChIKey | UTOAXDSCYKJUMT-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C=C21)CCC(=O)O |
Computed by PubChem (NCBI)