CAS 1255147-44-4 appears in our catalog under these names: 6-(Chloromethyl)-n,1-dimethyl-1h-pyrazolo[3,4-d]pyrimidin-4-amine, 95%, 6-(Chloromethyl)-N,1-dimethyl-1H-pyrazolo(3,4-d)pyrimidin-4-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-(chloromethyl)-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 1255147-44-4) is a chemical compound with the molecular formula C8H10ClN5 and a molecular weight of 211.65 g/mol. IUPAC name: 6-(chloromethyl)-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: BOSRHAZBAVIABA-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN5 |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 6-(chloromethyl)-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | BOSRHAZBAVIABA-UHFFFAOYSA-N |
| SMILES | CNC1=C2C=NN(C2=NC(=N1)CCl)C |
Computed by PubChem (NCBI)