CAS 244030-28-2 is the registry number for 6-Chloro-9-isopropyl-9H-purin-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
6-chloro-9-propan-2-ylpurin-2-amine (CAS 244030-28-2) is a chemical compound with the molecular formula C8H10ClN5 and a molecular weight of 211.65 g/mol. IUPAC name: 6-chloro-9-propan-2-ylpurin-2-amine. InChIKey: JZUJPTIMHWPRFK-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN5 |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 6-chloro-9-propan-2-ylpurin-2-amine |
| InChIKey | JZUJPTIMHWPRFK-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NC2=C1N=C(N=C2Cl)N |
Computed by PubChem (NCBI)