CAS 1268982-31-5 is the registry number for [5-Methyl-2-(1h-tetrazol-1-yl)phenyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-methyl-2-(tetrazol-1-yl)aniline;hydrochloride (CAS 1268982-31-5) is a chemical compound with the molecular formula C8H10ClN5 and a molecular weight of 211.65 g/mol. IUPAC name: 5-methyl-2-(tetrazol-1-yl)aniline;hydrochloride. InChIKey: SOSPSGNMZKWAKP-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN5 |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 5-methyl-2-(tetrazol-1-yl)aniline;hydrochloride |
| InChIKey | SOSPSGNMZKWAKP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C=NN=N2)N.Cl |
Computed by PubChem (NCBI)