CAS 137588-53-5 appears in our catalog under these names: N-(2-Chlorophenyl)-n'-(diaminomethylene)guanidine, 95%, N-(2-chlorophenyl)-N'-(diaminomethylene)guanidine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2-chlorophenyl)-1-(diaminomethylidene)guanidine (CAS 137588-53-5) is a chemical compound with the molecular formula C8H10ClN5 and a molecular weight of 211.65 g/mol. IUPAC name: 2-(2-chlorophenyl)-1-(diaminomethylidene)guanidine. InChIKey: MKWFJPZMYHPQIA-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN5 |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1-(diaminomethylidene)guanidine |
| InChIKey | MKWFJPZMYHPQIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=C(N)N=C(N)N)Cl |
Computed by PubChem (NCBI)