CAS 1909348-25-9 appears in our catalog under these names: [5-(pyridin-4-yl)-4h-1,2,4-triazol-3-yl]methanamine hydrochloride, 95%, (5-(Pyridin-4-yl)-4H-1,2,4-triazol-3-yl)methanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methanamine;hydrochloride (CAS 1909348-25-9) is a chemical compound with the molecular formula C8H10ClN5 and a molecular weight of 211.65 g/mol. IUPAC name: (3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methanamine;hydrochloride. InChIKey: ZTYDDJZHYZWHIS-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN5 |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | (3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methanamine;hydrochloride |
| InChIKey | ZTYDDJZHYZWHIS-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NNC(=N2)CN.Cl |
Computed by PubChem (NCBI)