CAS 2097360-74-0 is the registry number for Ethyl 3-(4-oxo-4,5,6,7-tetrahydro-1H-indazol-1-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(4-oxo-6,7-dihydro-5H-indazol-1-yl)benzoate (CAS 2097360-74-0) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: ethyl 3-(4-oxo-6,7-dihydro-5H-indazol-1-yl)benzoate. InChIKey: KHWUQVHTBAIMNL-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | ethyl 3-(4-oxo-6,7-dihydro-5H-indazol-1-yl)benzoate |
| InChIKey | KHWUQVHTBAIMNL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)N2C3=C(C=N2)C(=O)CCC3 |
Computed by PubChem (NCBI)