CAS 1255574-36-7 is the registry number for 2-Amino-5-(4'-methylbiphenyl-4-yl)-1,3,4-thiadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-[4-(4-methylphenyl)phenyl]-1,3,4-thiadiazol-2-amine (CAS 1255574-36-7) is a chemical compound with the molecular formula C15H13N3S and a molecular weight of 267.4 g/mol. IUPAC name: 5-[4-(4-methylphenyl)phenyl]-1,3,4-thiadiazol-2-amine. InChIKey: FRSLWDFUGLTQLL-UHFFFAOYSA-N.
| Molecular formula | C15H13N3S |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | 5-[4-(4-methylphenyl)phenyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | FRSLWDFUGLTQLL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C3=NN=C(S3)N |
Computed by PubChem (NCBI)