CAS 74801-72-2 is the registry number for 5-Benzhydryl-[1,3,4]thiadiazol-2-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-benzhydryl-1,3,4-thiadiazol-2-amine (CAS 74801-72-2) is a chemical compound with the molecular formula C15H13N3S and a molecular weight of 267.4 g/mol. IUPAC name: 5-benzhydryl-1,3,4-thiadiazol-2-amine. InChIKey: RMBPSQWMIZENQJ-UHFFFAOYSA-N.
| Molecular formula | C15H13N3S |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | 5-benzhydryl-1,3,4-thiadiazol-2-amine |
| InChIKey | RMBPSQWMIZENQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=NN=C(S3)N |
Computed by PubChem (NCBI)