CAS 63314-58-9 appears in our catalog under these names: 5-Phenyl-4-(p-tolyl)-4H-1,2,4-triazole-3-thiol, 97%, 4-(4-Methylphenyl)-5-phenyl-4H-1,2,4-triazole-3-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-(4-methylphenyl)-3-phenyl-1H-1,2,4-triazole-5-thione (CAS 63314-58-9) is a chemical compound with the molecular formula C15H13N3S and a molecular weight of 267.4 g/mol. IUPAC name: 4-(4-methylphenyl)-3-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: KBHKRHWQRBASFL-UHFFFAOYSA-N.
| Molecular formula | C15H13N3S |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | 4-(4-methylphenyl)-3-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | KBHKRHWQRBASFL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=NNC2=S)C3=CC=CC=C3 |
Computed by PubChem (NCBI)