CAS 22478-90-6 appears in our catalog under these names: 5-Benzyl-4-phenyl-4h-1,2,4-triazole-3-thiol, 95%, 5-Benzyl-4-phenyl-4H-1,2,4-triazole-3-thiol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
3-benzyl-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 22478-90-6) is a chemical compound with the molecular formula C15H13N3S and a molecular weight of 267.4 g/mol. IUPAC name: 3-benzyl-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: NORNNMHDCZHPNP-UHFFFAOYSA-N.
| Molecular formula | C15H13N3S |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | 3-benzyl-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | NORNNMHDCZHPNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NNC(=S)N2C3=CC=CC=C3 |
Computed by PubChem (NCBI)