Products 2049681-10-7
CAS 2049681-10-7 is the registry number for AChE/hCA I/II-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-benzyl-6-thiophen-2-ylpyrimidin-2-amine (CAS 2049681-10-7) is a chemical compound with the molecular formula C15H13N3S and a molecular weight of 267.4 g/mol. IUPAC name: 4-benzyl-6-thiophen-2-ylpyrimidin-2-amine. InChIKey: ZUDXOSDKHSIVSJ-UHFFFAOYSA-N.
| Molecular formula | C15H13N3S |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | 4-benzyl-6-thiophen-2-ylpyrimidin-2-amine |
| InChIKey | ZUDXOSDKHSIVSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=NC(=N2)N)C3=CC=CS3 |
Computed by PubChem (NCBI)