CAS 1255646-95-7 appears in our catalog under these names: Bortezomib Impurity 69, (S)-2-((S)-2-Amino-3-phenylpropanamido)-2-phenylacetic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-phenylacetic acid (CAS 1255646-95-7) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-phenylacetic acid. InChIKey: CENDSOALSUIALC-GJZGRUSLSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-phenylacetic acid |
| InChIKey | CENDSOALSUIALC-GJZGRUSLSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](C2=CC=CC=C2)C(=O)O)N |
Computed by PubChem (NCBI)