Products 1255717-24-8
CAS 1255717-24-8 is the registry number for 5-(3-Methoxyphenyl)-1,3-cyclohexanedione hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
5-(3-methoxyphenyl)cyclohexane-1,3-dione;hydrate (CAS 1255717-24-8) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 5-(3-methoxyphenyl)cyclohexane-1,3-dione;hydrate. InChIKey: VZKCVPJBIRYSNF-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)cyclohexane-1,3-dione;hydrate |
| InChIKey | VZKCVPJBIRYSNF-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2CC(=O)CC(=O)C2.O |
Computed by PubChem (NCBI)