CAS 1255718-19-4 appears in our catalog under these names: 1-(3-Azetidinyl)-3,5-dimethyl-1h-pyrazole dihydrochloride, 95%, 1-(Azetidin-3-yl)-3,5-dimethyl-1H-pyrazole dihydrochloride, 97%, 1-(Azetidin-3-yl)-3,5-dimethyl-1H-pyrazole dihydrochloride, 1-(3-azetidinyl)-3,5-dimethyl-1H-pyrazole dihydrochloride, 97%, 97%, 1-(3-azetidinyl)-3,5-dimethyl-1H-pyrazole dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg.
1-(azetidin-3-yl)-3,5-dimethylpyrazole;dihydrochloride (CAS 1255718-19-4) is a chemical compound with the molecular formula C8H15Cl2N3 and a molecular weight of 224.13 g/mol. IUPAC name: 1-(azetidin-3-yl)-3,5-dimethylpyrazole;dihydrochloride. InChIKey: DMHQQQXFDORIKH-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3 |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 1-(azetidin-3-yl)-3,5-dimethylpyrazole;dihydrochloride |
| InChIKey | DMHQQQXFDORIKH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2CNC2)C.Cl.Cl |
Computed by PubChem (NCBI)