CAS 1255777-72-0 is the registry number for 2-(1,3-Benzodioxol-5-yl)pyrazolo[1,5-a]pyrazin-4(5h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(1,3-benzodioxol-5-yl)-5H-pyrazolo[1,5-a]pyrazin-4-one (CAS 1255777-72-0) is a chemical compound with the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-5H-pyrazolo[1,5-a]pyrazin-4-one. InChIKey: ABXBHZNNWQXXLE-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O3 |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-5H-pyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | ABXBHZNNWQXXLE-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NN4C=CNC(=O)C4=C3 |
Computed by PubChem (NCBI)