CAS 1360867-59-9 is the registry number for 6-(2H-Benzo[d][1,2,3]triazol-2-yl)benzo[d][1,3]dioxol-5-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(benzotriazol-2-yl)-1,3-benzodioxol-5-ol (CAS 1360867-59-9) is a chemical compound with the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. IUPAC name: 6-(benzotriazol-2-yl)-1,3-benzodioxol-5-ol. InChIKey: ZHUDUGOMUBIMEK-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O3 |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | 6-(benzotriazol-2-yl)-1,3-benzodioxol-5-ol |
| InChIKey | ZHUDUGOMUBIMEK-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)N3N=C4C=CC=CC4=N3)O |
Computed by PubChem (NCBI)