Products 68302-07-8
CAS 68302-07-8 is the registry number for DNA ligase-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-5-oxochromeno[2,3-b]pyridine-3-carboxamide (CAS 68302-07-8) is a chemical compound with the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. IUPAC name: 2-amino-5-oxochromeno[2,3-b]pyridine-3-carboxamide. InChIKey: OBGGBMBGYHZQBR-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O3 |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | 2-amino-5-oxochromeno[2,3-b]pyridine-3-carboxamide |
| InChIKey | OBGGBMBGYHZQBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(N=C3O2)N)C(=O)N |
Computed by PubChem (NCBI)
Synonyms:
DNA ligase-IN-1, orb2814554