CAS 953745-07-8 appears in our catalog under these names: 3-Methyl-6-(pyridin-3-yl)isoxazolo(5,4-b)pyridine-4-carboxylic acid, 97%, 3-Methyl-6-(pyridin-3-yl)-(1,2)oxazolo(5,4-b)pyridine-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-methyl-6-pyridin-3-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 953745-07-8) is a chemical compound with the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. IUPAC name: 3-methyl-6-pyridin-3-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: PSNZOTORGKSYLK-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O3 |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | 3-methyl-6-pyridin-3-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | PSNZOTORGKSYLK-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=CC(=N2)C3=CN=CC=C3)C(=O)O |
Computed by PubChem (NCBI)