CAS 1500627-24-6 appears in our catalog under these names: 5-(1-Phenyl-1H-pyrazol-4-yl)-1,2-oxazole-4-carboxylic acid, 95%, 5-(1-Phenyl-1H-pyrazol-4-yl)-1,2-oxazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(1-phenylpyrazol-4-yl)-1,2-oxazole-4-carboxylic acid (CAS 1500627-24-6) is a chemical compound with the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. IUPAC name: 5-(1-phenylpyrazol-4-yl)-1,2-oxazole-4-carboxylic acid. InChIKey: HSIHBJJDFZNMTJ-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O3 |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | 5-(1-phenylpyrazol-4-yl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | HSIHBJJDFZNMTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C=N2)C3=C(C=NO3)C(=O)O |
Computed by PubChem (NCBI)