Products 188636-22-8

CAS 188636-22-8 is the registry number for Captopril Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 188636-22-8) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: (2R)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: ZNQRGUYIKSRYCI-VXNVDRBHSA-N.

Identity
Molecular formulaC11H17NO4S
Molecular weight259.32 g/mol
IUPAC name(2R)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid
InChIKeyZNQRGUYIKSRYCI-VXNVDRBHSA-N
SMILESC[C@H](CSC(=O)C)C(=O)N1CCC[C@@H]1C(=O)O

Computed by PubChem (NCBI)