CAS 224626-08-8 is the registry number for Captopril Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-1-[(2R)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 224626-08-8) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: (2R)-1-[(2R)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: ZNQRGUYIKSRYCI-IONNQARKSA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | (2R)-1-[(2R)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ZNQRGUYIKSRYCI-IONNQARKSA-N |
| SMILES | C[C@@H](CSC(=O)C)C(=O)N1CCC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)