Products 1256345-69-3
CAS 1256345-69-3 appears in our catalog under these names: (3–(2–Ethoxy–2–oxoethyl)phenyl)boronic acid, (3-(2-Ethoxy-2-Oxoethyl)Phenyl)Boronic Acid, 97%, 97%, (3-(2-Ethoxy-2-oxoethyl)phenyl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g.
[3-(2-ethoxy-2-oxoethyl)phenyl]boronic acid (CAS 1256345-69-3) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: [3-(2-ethoxy-2-oxoethyl)phenyl]boronic acid. InChIKey: GDWZKERCECMYJX-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | [3-(2-ethoxy-2-oxoethyl)phenyl]boronic acid |
| InChIKey | GDWZKERCECMYJX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CC(=O)OCC)(O)O |
Computed by PubChem (NCBI)