Products 1256346-06-1
CAS 1256346-06-1 appears in our catalog under these names: (3-Methyl-5-propoxyphenyl)boronic acid, 98%, 3-Methyl-5-propoxyphenylboronic acid, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3-methyl-5-propoxyphenyl)boronic acid (CAS 1256346-06-1) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (3-methyl-5-propoxyphenyl)boronic acid. InChIKey: JVIXETMMBNQDES-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (3-methyl-5-propoxyphenyl)boronic acid |
| InChIKey | JVIXETMMBNQDES-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OCCC)C)(O)O |
Computed by PubChem (NCBI)