Products 1256346-14-1
CAS 1256346-14-1 appears in our catalog under these names: (2–Chloro–5–propoxyphenyl)boronic acid, (2-Chloro-5-propoxyphenyl)boronic acid, 97%, (2-Chloro-5-propoxyphenyl)boronic acid, 96%, 2-Chloro-5-propoxyphenylboronic acid, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
(2-chloro-5-propoxyphenyl)boronic acid (CAS 1256346-14-1) is a chemical compound with the molecular formula C9H12BClO3 and a molecular weight of 214.45 g/mol. IUPAC name: (2-chloro-5-propoxyphenyl)boronic acid. InChIKey: ZCCYRXLLDQAMRN-UHFFFAOYSA-N.
| Molecular formula | C9H12BClO3 |
|---|---|
| Molecular weight | 214.45 g/mol |
| IUPAC name | (2-chloro-5-propoxyphenyl)boronic acid |
| InChIKey | ZCCYRXLLDQAMRN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCCC)Cl)(O)O |
Computed by PubChem (NCBI)