CAS 1256388-47-2 appears in our catalog under these names: (6S)-5-Azaspiro[2.4]heptane-5,6-dicarboxylic acid 5-(phenylmethyl) ester, 95%, (S)-5-((Benzyloxy)carbonyl)-5-azaspiro(2.4)heptane-6-carboxylic acid, 98+%, (6S)–5–((Benzyloxy)carbonyl)–5–azaspiro(2·4)heptane–6–carboxylic acid, (S)-5-((Benzyloxy)carbonyl)-5-azaspiro[2.4]heptane-6-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
(6S)-5-phenylmethoxycarbonyl-5-azaspiro[2.4]heptane-6-carboxylic acid (CAS 1256388-47-2) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: (6S)-5-phenylmethoxycarbonyl-5-azaspiro[2.4]heptane-6-carboxylic acid. InChIKey: MWFCRIFLQUONPW-LBPRGKRZSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (6S)-5-phenylmethoxycarbonyl-5-azaspiro[2.4]heptane-6-carboxylic acid |
| InChIKey | MWFCRIFLQUONPW-LBPRGKRZSA-N |
| SMILES | C1CC12C[C@H](N(C2)C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)