CAS 125652-30-4 is the registry number for 1,2–bis(2–fluorophenyl)–2–hydroxyethan–1–one. Offered by: GLPBio. Available pack sizes: 100g, 25g, 5g.
1,2-bis(2-fluorophenyl)-2-hydroxyethanone (CAS 125652-30-4) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 1,2-bis(2-fluorophenyl)-2-hydroxyethanone. InChIKey: XQFHNDNXOUWJPU-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 1,2-bis(2-fluorophenyl)-2-hydroxyethanone |
| InChIKey | XQFHNDNXOUWJPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)C2=CC=CC=C2F)O)F |
Computed by PubChem (NCBI)