CAS 1256811-43-4 appears in our catalog under these names: 4-Chloro-7-methoxypyrido(3,2-d)pyrimidine, 4-Chloro-7-methoxypyrido[3,2-d]pyrimidine, 95%, 4-Chloro-7-methoxypyrido(3,2-d)pyrimidine, 97%, 4-Chloro-7-methoxypyrido[3,2-d]pyrimidine, 97%, 97%. Offered by: Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 100mg, 5g, 500mg.
4-chloro-7-methoxypyrido[3,2-d]pyrimidine (CAS 1256811-43-4) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 4-chloro-7-methoxypyrido[3,2-d]pyrimidine. InChIKey: VDSBLLZHATXYRY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 4-chloro-7-methoxypyrido[3,2-d]pyrimidine |
| InChIKey | VDSBLLZHATXYRY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=NC=N2)Cl)N=C1 |
Computed by PubChem (NCBI)