CAS 90002-06-5 appears in our catalog under these names: 2-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]pyridine, 98%, 5-(Chloromethyl)-3-(pyridin-2-yl)-1,2,4-oxadiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
5-(chloromethyl)-3-pyridin-2-yl-1,2,4-oxadiazole (CAS 90002-06-5) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 5-(chloromethyl)-3-pyridin-2-yl-1,2,4-oxadiazole. InChIKey: JMMBCYRZDCWVIB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-(chloromethyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| InChIKey | JMMBCYRZDCWVIB-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)