CAS 28751-70-4 appears in our catalog under these names: 5-Chloro-1h-indazole-3-carboxamide, 95%, 5-Chloro-1H-indazole-3-carboxamide, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.
5-chloro-1H-indazole-3-carboxamide (CAS 28751-70-4) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 5-chloro-1H-indazole-3-carboxamide. InChIKey: LDYDVRNVSHVIBN-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-chloro-1H-indazole-3-carboxamide |
| InChIKey | LDYDVRNVSHVIBN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NN2)C(=O)N |
Computed by PubChem (NCBI)