CAS 1673-45-6 is the registry number for 5-(3-Chlorophenyl)-1,3,4-oxadiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-(3-chlorophenyl)-1,3,4-oxadiazol-2-amine (CAS 1673-45-6) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 5-(3-chlorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: ZESRETSPEZRIPB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | ZESRETSPEZRIPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NN=C(O2)N |
Computed by PubChem (NCBI)