CAS 33621-61-3 appears in our catalog under these names: 5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-amine, 98%, 2–Amino–5–(4–chlorophenyl)–1,3,4–oxadiazole, 2-Amino-5-(4-chlorophenyl)-1,3,4-oxadiazole. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g.
5-(4-chlorophenyl)-1,3,4-oxadiazol-2-amine (CAS 33621-61-3) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: ZMWWZXSPDQIWAZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | ZMWWZXSPDQIWAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)N)Cl |
Computed by PubChem (NCBI)