Products 1256816-92-8
CAS 1256816-92-8 is the registry number for 5-Chloro-3-methoxy-1,6-naphthyridine, 98+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-3-methoxy-1,6-naphthyridine (CAS 1256816-92-8) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 5-chloro-3-methoxy-1,6-naphthyridine. InChIKey: WYWQIWOJVWQSHI-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-chloro-3-methoxy-1,6-naphthyridine |
| InChIKey | WYWQIWOJVWQSHI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CN=C2Cl)N=C1 |
Computed by PubChem (NCBI)