Products 1256834-88-4
CAS 1256834-88-4 appears in our catalog under these names: 2-Chloro-5,6,7,8-tetrahydroquinoline-6-carboxylic acid, 95+%, 95+%, 2-Chloro-5,6,7,8-tetrahydroquinoline-6-carboxylic acid, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 50mg, 100mg, 250mg.
2-chloro-5,6,7,8-tetrahydroquinoline-6-carboxylic acid (CAS 1256834-88-4) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 2-chloro-5,6,7,8-tetrahydroquinoline-6-carboxylic acid. InChIKey: KRKHVCGNVDEZLD-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 2-chloro-5,6,7,8-tetrahydroquinoline-6-carboxylic acid |
| InChIKey | KRKHVCGNVDEZLD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)C=CC(=N2)Cl |
Computed by PubChem (NCBI)