CAS 1256955-32-4 is the registry number for 6-Bromo-4,7-dichloroquinazoline, 97%. Offered by: AmBeed. Available pack sizes: 5g.
6-bromo-4,7-dichloroquinazoline (CAS 1256955-32-4) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-4,7-dichloroquinazoline. InChIKey: FKUZYQQFPBBHKU-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-4,7-dichloroquinazoline |
| InChIKey | FKUZYQQFPBBHKU-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Cl)N=CN=C2Cl |
Computed by PubChem (NCBI)