CAS 1258283-07-6 appears in our catalog under these names: 4-Methyl-3-(pyridine-2-sulfonyl)-thiophene-2-carbaldehyde, 95%, 4–Methyl–3–(pyridin–2–ylsulfonyl)thiophene–2–carbaldehyde. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
4-methyl-3-pyridin-2-ylsulfonylthiophene-2-carbaldehyde (CAS 1258283-07-6) is a chemical compound with the molecular formula C11H9NO3S2 and a molecular weight of 267.3 g/mol. IUPAC name: 4-methyl-3-pyridin-2-ylsulfonylthiophene-2-carbaldehyde. InChIKey: LPHPJJDCXVMFNI-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3S2 |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | 4-methyl-3-pyridin-2-ylsulfonylthiophene-2-carbaldehyde |
| InChIKey | LPHPJJDCXVMFNI-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=C1S(=O)(=O)C2=CC=CC=N2)C=O |
Computed by PubChem (NCBI)