Products 926847-62-3
CAS 926847-62-3 is the registry number for Methyl 3-(thiophene-3-carboxamido)thiophene-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(thiophene-3-carbonylamino)thiophene-2-carboxylate (CAS 926847-62-3) is a chemical compound with the molecular formula C11H9NO3S2 and a molecular weight of 267.3 g/mol. IUPAC name: methyl 3-(thiophene-3-carbonylamino)thiophene-2-carboxylate. InChIKey: VUCRBLRYKBQOSB-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3S2 |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | methyl 3-(thiophene-3-carbonylamino)thiophene-2-carboxylate |
| InChIKey | VUCRBLRYKBQOSB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)NC(=O)C2=CSC=C2 |
Computed by PubChem (NCBI)