Products 380640-18-6

CAS 380640-18-6 is the registry number for 2-Acetamido-4-(thiophen-2-yl)thiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-acetamido-4-thiophen-2-ylthiophene-3-carboxylic acid (CAS 380640-18-6) is a chemical compound with the molecular formula C11H9NO3S2 and a molecular weight of 267.3 g/mol. IUPAC name: 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylic acid. InChIKey: JVGWTBSLLYTTDI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO3S2
Molecular weight267.3 g/mol
IUPAC name2-acetamido-4-thiophen-2-ylthiophene-3-carboxylic acid
InChIKeyJVGWTBSLLYTTDI-UHFFFAOYSA-N
SMILESCC(=O)NC1=C(C(=CS1)C2=CC=CS2)C(=O)O

Computed by PubChem (NCBI)