CAS 545351-07-3 is the registry number for methyl 3-(2-thienylcarbonylamino)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl 3-(thiophene-2-carbonylamino)thiophene-2-carboxylate (CAS 545351-07-3) is a chemical compound with the molecular formula C11H9NO3S2 and a molecular weight of 267.3 g/mol. IUPAC name: methyl 3-(thiophene-2-carbonylamino)thiophene-2-carboxylate. InChIKey: KDIUXLDOFBPLPL-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3S2 |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | methyl 3-(thiophene-2-carbonylamino)thiophene-2-carboxylate |
| InChIKey | KDIUXLDOFBPLPL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)NC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)