Products 72731-86-3

CAS 72731-86-3 appears in our catalog under these names: S-(1,3-Dioxoisoindolin-2-yl) O-ethyl carbonodithioate, 95%, 95%, S-(1,3-Dioxoisoindolin-2-yl) O-ethyl carbonodithioate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

O-ethyl (1,3-dioxoisoindol-2-yl)sulfanylmethanethioate (CAS 72731-86-3) is a chemical compound with the molecular formula C11H9NO3S2 and a molecular weight of 267.3 g/mol. IUPAC name: O-ethyl (1,3-dioxoisoindol-2-yl)sulfanylmethanethioate. InChIKey: HILXBUBOBAJKEC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO3S2
Molecular weight267.3 g/mol
IUPAC nameO-ethyl (1,3-dioxoisoindol-2-yl)sulfanylmethanethioate
InChIKeyHILXBUBOBAJKEC-UHFFFAOYSA-N
SMILESCCOC(=S)SN1C(=O)C2=CC=CC=C2C1=O

Computed by PubChem (NCBI)