CAS 1258503-55-7 appears in our catalog under these names: 5-{((tert-Butoxy)carbonyl)amino}-1,2-oxazoacidle-3-carboxylic, 5-((tert-Butoxycarbonyl)amino)isoxazole-3-carboxylic acid, 95+%, 5-{((tert-Butoxy)carbonyl)amino}-1,2-oxazole-3-carboxylic acid. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 1g, 50mg.
5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-oxazole-3-carboxylic acid (CAS 1258503-55-7) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-oxazole-3-carboxylic acid. InChIKey: CCCHFCPUBYWBCF-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-oxazole-3-carboxylic acid |
| InChIKey | CCCHFCPUBYWBCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NO1)C(=O)O |
Computed by PubChem (NCBI)