Products 1258512-08-1
CAS 1258512-08-1 is the registry number for 2-(1,3-Dioxolan-2-yl)-5-fluorobenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(1,3-dioxolan-2-yl)-5-fluorobenzaldehyde (CAS 1258512-08-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: 2-(1,3-dioxolan-2-yl)-5-fluorobenzaldehyde. InChIKey: QUKDAGGBSSSZCM-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 2-(1,3-dioxolan-2-yl)-5-fluorobenzaldehyde |
| InChIKey | QUKDAGGBSSSZCM-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2)F)C=O |
Computed by PubChem (NCBI)